C10H19F2N3 — CID 116991229
1-[(4,4-difluoropiperidin-1-yl)methyl]piperazine (PubChem CID 116991229) has the molecular formula C10H19F2N3 and a molecular weight of 219.28 g/mol. Its IUPAC name is 1-[(4,4-difluoropiperidin-1-yl)methyl]piperazine.
| Compound Name | 1-[(4,4-difluoropiperidin-1-yl)methyl]piperazine |
|---|---|
| PubChem CID | 116991229 |
| Molecular Formula | C10H19F2N3 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 1-[(4,4-difluoropiperidin-1-yl)methyl]piperazine |
| SMILES | FC1(F)CCN(CN2CCNCC2)CC1 |
| InChI | InChI=1S/C10H19F2N3/c11-10(12)1-5-14(6-2-10)9-15-7-3-13-4-8-15/h13H,1-9H2 |
| InChIKey | WFAMJVJKEAWABM-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |