C16H27BrF4N2O4 — CID 157428618
4,4-difluoropiperidine;methyl 2-bromoacetate;methyl 2-(4,4-difluoropiperidin-1-yl)acetate (PubChem CID 157428618) has the molecular formula C16H27BrF4N2O4 and a molecular weight of 467.30 g/mol. Its IUPAC name is 4,4-difluoropiperidine;methyl 2-bromoacetate;methyl 2-(4,4-difluoropiperidin-1-yl)acetate.
| Compound Name | 4,4-difluoropiperidine;methyl 2-bromoacetate;methyl 2-(4,4-difluoropiperidin-1-yl)acetate |
|---|---|
| PubChem CID | 157428618 |
| Molecular Formula | C16H27BrF4N2O4 |
| Molecular Weight | 467.30 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 4,4-difluoropiperidine;methyl 2-bromoacetate;methyl 2-(4,4-difluoropiperidin-1-yl)acetate |
| SMILES | COC(=O)CBr.COC(=O)CN1CCC(F)(F)CC1.FC1(F)CCNCC1 |
| InChI | InChI=1S/C8H13F2NO2.C5H9F2N.C3H5BrO2/c1-13-7(12)6-11-4-2-8(9,10)3-5-11;6-5(7)1-3-8-4-2-5;1-6-3(5)2-4/h2-6H2,1H3;8H,1-4H2;2H2,1H3 |
| InChIKey | BQGKFHNLIMSTGW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|