C12H23F2N3 — CID 116991618
1-[4-(3,3-difluoropyrrolidin-1-yl)butyl]piperazine (PubChem CID 116991618) has the molecular formula C12H23F2N3 and a molecular weight of 247.33 g/mol. Its IUPAC name is 1-[4-(3,3-difluoropyrrolidin-1-yl)butyl]piperazine.
| Compound Name | 1-[4-(3,3-difluoropyrrolidin-1-yl)butyl]piperazine |
|---|---|
| PubChem CID | 116991618 |
| Molecular Formula | C12H23F2N3 |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 1-[4-(3,3-difluoropyrrolidin-1-yl)butyl]piperazine |
| SMILES | FC1(F)CCN(CCCCN2CCNCC2)C1 |
| InChI | InChI=1S/C12H23F2N3/c13-12(14)3-8-17(11-12)7-2-1-6-16-9-4-15-5-10-16/h15H,1-11H2 |
| InChIKey | RCLXAXRDXXMKBC-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|