C8H15ClF4N2 — CID 159412797
3,3-difluoroazetidine;4,4-difluoropiperidine;hydrochloride (PubChem CID 159412797) has the molecular formula C8H15ClF4N2 and a molecular weight of 250.67 g/mol. Its IUPAC name is 3,3-difluoroazetidine;4,4-difluoropiperidine;hydrochloride.
| Compound Name | 3,3-difluoroazetidine;4,4-difluoropiperidine;hydrochloride |
|---|---|
| PubChem CID | 159412797 |
| Molecular Formula | C8H15ClF4N2 |
| Molecular Weight | 250.67 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 3,3-difluoroazetidine;4,4-difluoropiperidine;hydrochloride |
| SMILES | Cl.FC1(F)CCNCC1.FC1(F)CNC1 |
| InChI | InChI=1S/C5H9F2N.C3H5F2N.ClH/c6-5(7)1-3-8-4-2-5;4-3(5)1-6-2-3;/h8H,1-4H2;6H,1-2H2;1H |
| InChIKey | VSAKRPIYEVUYLW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.67 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |