C8H17F2N — CID 142117389
3,3-difluoroazepane;ethane (PubChem CID 142117389) has the molecular formula C8H17F2N and a molecular weight of 165.23 g/mol. Its IUPAC name is 3,3-difluoroazepane;ethane.
| Compound Name | 3,3-difluoroazepane;ethane |
|---|---|
| PubChem CID | 142117389 |
| Molecular Formula | C8H17F2N |
| Molecular Weight | 165.23 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 3,3-difluoroazepane;ethane |
| SMILES | CC.FC1(F)CCCCNC1 |
| InChI | InChI=1S/C6H11F2N.C2H6/c7-6(8)3-1-2-4-9-5-6;1-2/h9H,1-5H2;1-2H3 |
| InChIKey | VOOHHKWGSICXHN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.23 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |