About 1,1,2,2-tetrafluoro-6-azaspiro[2.5]octane;hydrochloride
1,1,2,2-tetrafluoro-6-azaspiro[2.5]octane;hydrochloride (PubChem CID 122163593) has the molecular formula C7H10ClF4N
and a molecular weight of 219.61 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-6-azaspiro[2.5]octane;hydrochloride.
Molecular Properties
| Compound Name | 1,1,2,2-tetrafluoro-6-azaspiro[2.5]octane;hydrochloride |
| PubChem CID | 122163593 |
| Molecular Formula | C7H10ClF4N |
| Molecular Weight | 219.61 g/mol |
| Exact Mass | 219.04 |
| IUPAC Name | 1,1,2,2-tetrafluoro-6-azaspiro[2.5]octane;hydrochloride |
| SMILES | Cl.FC1(F)C(F)(F)C12CCNCC2 |
| InChI | InChI=1S/C7H9F4N.ClH/c8-6(9)5(7(6,10)11)1-3-12-4-2-5;/h12H,1-4H2;1H |
| InChIKey | YKVQMGBTQSMAJC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.61 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,1,2,2-tetrafluoro-6-azaspiro[2.5]octane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,2,2-tetrafluoro-6-azaspiro[2.5]octane;hydrochloride?
The IUPAC name of 1,1,2,2-tetrafluoro-6-azaspiro[2.5]octane;hydrochloride (CID 122163593) is 1,1,2,2-tetrafluoro-6-azaspiro[2.5]octane;hydrochloride.
What is the SMILES notation for 1,1,2,2-tetrafluoro-6-azaspiro[2.5]octane;hydrochloride?
The canonical SMILES for 1,1,2,2-tetrafluoro-6-azaspiro[2.5]octane;hydrochloride is Cl.FC1(F)C(F)(F)C12CCNCC2.
What is the InChIKey of 1,1,2,2-tetrafluoro-6-azaspiro[2.5]octane;hydrochloride?
The InChIKey is YKVQMGBTQSMAJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F4N.ClH/c8-6(9)5(7(6,10)11)1-3-12-4-2-5;/h12H,1-4H2;1H.
What are the key properties of 1,1,2,2-tetrafluoro-6-azaspiro[2.5]octane;hydrochloride?
1,1,2,2-tetrafluoro-6-azaspiro[2.5]octane;hydrochloride has a molecular weight of 219.61 g/mol, XLogP of 2.06, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,2,2-tetrafluoro-6-azaspiro[2.5]octane;hydrochloride is sourced from PubChem (CID 122163593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).