About 4,4-difluoropiperidine;trichloro(deuterio)methane
4,4-difluoropiperidine;trichloro(deuterio)methane (PubChem CID 158251836) has the molecular formula C6H10Cl3F2N
and a molecular weight of 241.51 g/mol. Its IUPAC name is 4,4-difluoropiperidine;trichloro(deuterio)methane.
Molecular Properties
| Compound Name | 4,4-difluoropiperidine;trichloro(deuterio)methane |
| PubChem CID | 158251836 |
| Molecular Formula | C6H10Cl3F2N |
| Molecular Weight | 241.51 g/mol |
| Exact Mass | 239.99 |
| IUPAC Name | 4,4-difluoropiperidine;trichloro(deuterio)methane |
| SMILES | FC1(F)CCNCC1.[2H]C(Cl)(Cl)Cl |
| InChI | InChI=1S/C5H9F2N.CHCl3/c6-5(7)1-3-8-4-2-5;2-1(3)4/h8H,1-4H2;1H/i;1D |
| InChIKey | GGURHSSMTPPNPI-DIYDOPDJSA-N |
| XLogP | 2.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4,4-difluoropiperidine;trichloro(deuterio)methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluoropiperidine;trichloro(deuterio)methane?
The IUPAC name of 4,4-difluoropiperidine;trichloro(deuterio)methane (CID 158251836) is 4,4-difluoropiperidine;trichloro(deuterio)methane.
What is the SMILES notation for 4,4-difluoropiperidine;trichloro(deuterio)methane?
The canonical SMILES for 4,4-difluoropiperidine;trichloro(deuterio)methane is FC1(F)CCNCC1.[2H]C(Cl)(Cl)Cl.
What is the InChIKey of 4,4-difluoropiperidine;trichloro(deuterio)methane?
The InChIKey is GGURHSSMTPPNPI-DIYDOPDJSA-N. The full InChI is InChI=1S/C5H9F2N.CHCl3/c6-5(7)1-3-8-4-2-5;2-1(3)4/h8H,1-4H2;1H/i;1D.
What are the key properties of 4,4-difluoropiperidine;trichloro(deuterio)methane?
4,4-difluoropiperidine;trichloro(deuterio)methane has a molecular weight of 241.51 g/mol, XLogP of 2.99, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoropiperidine;trichloro(deuterio)methane is sourced from PubChem (CID 158251836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).