C18H27NO5S — CID 87995700
[2-methyl-4-(4-methylphenyl)sulfonyloxybutan-2-yl] piperidine-4-carboxylate (PubChem CID 87995700) has the molecular formula C18H27NO5S and a molecular weight of 369.48 g/mol. Its IUPAC name is [2-methyl-4-(4-methylphenyl)sulfonyloxybutan-2-yl] piperidine-4-carboxylate.
| Compound Name | [2-methyl-4-(4-methylphenyl)sulfonyloxybutan-2-yl] piperidine-4-carboxylate |
|---|---|
| PubChem CID | 87995700 |
| Molecular Formula | C18H27NO5S |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | [2-methyl-4-(4-methylphenyl)sulfonyloxybutan-2-yl] piperidine-4-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OCCC(C)(C)OC(=O)C2CCNCC2)cc1 |
| InChI | InChI=1S/C18H27NO5S/c1-14-4-6-16(7-5-14)25(21,22)23-13-10-18(2,3)24-17(20)15-8-11-19-12-9-15/h4-7,15,19H,8-13H2,1-3H3 |
| InChIKey | NBQJALSIFZTWCQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|