C17H24O6S — CID 146443657
methyl 4-[2-(4-methylphenyl)sulfonyloxyethoxy]cyclohexane-1-carboxylate (PubChem CID 146443657) has the molecular formula C17H24O6S and a molecular weight of 356.44 g/mol. Its IUPAC name is methyl 4-[2-(4-methylphenyl)sulfonyloxyethoxy]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[2-(4-methylphenyl)sulfonyloxyethoxy]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 146443657 |
| Molecular Formula | C17H24O6S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | methyl 4-[2-(4-methylphenyl)sulfonyloxyethoxy]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(OCCOS(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C17H24O6S/c1-13-3-9-16(10-4-13)24(19,20)23-12-11-22-15-7-5-14(6-8-15)17(18)21-2/h3-4,9-10,14-15H,5-8,11-12H2,1-2H3 |
| InChIKey | KUVYBEDZDSPYKI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|