C15H21NO6S — CID 165405988
methyl (2S,4R)-4-[2-(4-methylphenyl)sulfonyloxyethoxy]pyrrolidine-2-carboxylate (PubChem CID 165405988) has the molecular formula C15H21NO6S and a molecular weight of 343.40 g/mol. Its IUPAC name is methyl (2S,4R)-4-[2-(4-methylphenyl)sulfonyloxyethoxy]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4R)-4-[2-(4-methylphenyl)sulfonyloxyethoxy]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 165405988 |
| Molecular Formula | C15H21NO6S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | methyl (2S,4R)-4-[2-(4-methylphenyl)sulfonyloxyethoxy]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H](OCCOS(=O)(=O)c2ccc(C)cc2)CN1 |
| InChI | InChI=1S/C15H21NO6S/c1-11-3-5-13(6-4-11)23(18,19)22-8-7-21-12-9-14(16-10-12)15(17)20-2/h3-6,12,14,16H,7-10H2,1-2H3/t12-,14+/m1/s1 |
| InChIKey | OSRYUMUEXCZWLI-OCCSQVGLSA-N |
| XLogP | 0.62 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|