C17H23NO4S — CID 91362010
(4-methylphenyl)sulfonyl 1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylate (PubChem CID 91362010) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is (4-methylphenyl)sulfonyl 1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylate.
| Compound Name | (4-methylphenyl)sulfonyl 1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 91362010 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | (4-methylphenyl)sulfonyl 1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OC(=O)C2CC3CCCCC3CN2)cc1 |
| InChI | InChI=1S/C17H23NO4S/c1-12-6-8-15(9-7-12)23(20,21)22-17(19)16-10-13-4-2-3-5-14(13)11-18-16/h6-9,13-14,16,18H,2-5,10-11H2,1H3 |
| InChIKey | ZRXXGJGKPDEWCR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|