C13H14F3NO4S — CID 87883244
[4-(trifluoromethyl)phenyl]sulfonyl piperidine-2-carboxylate (PubChem CID 87883244) has the molecular formula C13H14F3NO4S and a molecular weight of 337.32 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl]sulfonyl piperidine-2-carboxylate.
| Compound Name | [4-(trifluoromethyl)phenyl]sulfonyl piperidine-2-carboxylate |
|---|---|
| PubChem CID | 87883244 |
| Molecular Formula | C13H14F3NO4S |
| Molecular Weight | 337.32 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | [4-(trifluoromethyl)phenyl]sulfonyl piperidine-2-carboxylate |
| SMILES | O=C(OS(=O)(=O)c1ccc(C(F)(F)F)cc1)C1CCCCN1 |
| InChI | InChI=1S/C13H14F3NO4S/c14-13(15,16)9-4-6-10(7-5-9)22(19,20)21-12(18)11-3-1-2-8-17-11/h4-7,11,17H,1-3,8H2 |
| InChIKey | GCTFBKSEXDZLEE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|