C19H20ClNO5S — CID 135307037
(2-chlorophenyl)methyl (2R,4R)-4-(4-methylphenyl)sulfonyloxypyrrolidine-2-carboxylate (PubChem CID 135307037) has the molecular formula C19H20ClNO5S and a molecular weight of 409.89 g/mol. Its IUPAC name is (2-chlorophenyl)methyl (2R,4R)-4-(4-methylphenyl)sulfonyloxypyrrolidine-2-carboxylate.
| Compound Name | (2-chlorophenyl)methyl (2R,4R)-4-(4-methylphenyl)sulfonyloxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 135307037 |
| Molecular Formula | C19H20ClNO5S |
| Molecular Weight | 409.89 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | (2-chlorophenyl)methyl (2R,4R)-4-(4-methylphenyl)sulfonyloxypyrrolidine-2-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2CN[C@@H](C(=O)OCc3ccccc3Cl)C2)cc1 |
| InChI | InChI=1S/C19H20ClNO5S/c1-13-6-8-16(9-7-13)27(23,24)26-15-10-18(21-11-15)19(22)25-12-14-4-2-3-5-17(14)20/h2-9,15,18,21H,10-12H2,1H3/t15-,18-/m1/s1 |
| InChIKey | HNMFRURMXDBCQU-CRAIPNDOSA-N |
| XLogP | 2.83 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.89 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|