C13H15F2NO3 — CID 169198673
benzyl (2S,4R)-4-(difluoromethoxy)pyrrolidine-2-carboxylate (PubChem CID 169198673) has the molecular formula C13H15F2NO3 and a molecular weight of 271.26 g/mol. Its IUPAC name is benzyl (2S,4R)-4-(difluoromethoxy)pyrrolidine-2-carboxylate.
| Compound Name | benzyl (2S,4R)-4-(difluoromethoxy)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 169198673 |
| Molecular Formula | C13H15F2NO3 |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | benzyl (2S,4R)-4-(difluoromethoxy)pyrrolidine-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)[C@@H]1C[C@@H](OC(F)F)CN1 |
| InChI | InChI=1S/C13H15F2NO3/c14-13(15)19-10-6-11(16-7-10)12(17)18-8-9-4-2-1-3-5-9/h1-5,10-11,13,16H,6-8H2/t10-,11+/m1/s1 |
| InChIKey | ARIJCSUZKZMNFO-MNOVXSKESA-N |
| XLogP | 1.70 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |