C11H14ClNO2S — CID 70055979
benzyl 1,3-thiazolidine-4-carboxylate;hydrochloride (PubChem CID 70055979) has the molecular formula C11H14ClNO2S and a molecular weight of 259.76 g/mol. Its IUPAC name is benzyl 1,3-thiazolidine-4-carboxylate;hydrochloride.
| Compound Name | benzyl 1,3-thiazolidine-4-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 70055979 |
| Molecular Formula | C11H14ClNO2S |
| Molecular Weight | 259.76 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | benzyl 1,3-thiazolidine-4-carboxylate;hydrochloride |
| SMILES | Cl.O=C(OCc1ccccc1)C1CSCN1 |
| InChI | InChI=1S/C11H13NO2S.ClH/c13-11(10-7-15-8-12-10)14-6-9-4-2-1-3-5-9;/h1-5,10,12H,6-8H2;1H |
| InChIKey | FPNIIHNHQYOMJC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.76 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |