C15H22N2O4 — CID 19802280
2-aminopropanoic acid;benzyl pyrrolidine-2-carboxylate (PubChem CID 19802280) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-aminopropanoic acid;benzyl pyrrolidine-2-carboxylate.
| Compound Name | 2-aminopropanoic acid;benzyl pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 19802280 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 2-aminopropanoic acid;benzyl pyrrolidine-2-carboxylate |
| SMILES | CC(N)C(=O)O.O=C(OCc1ccccc1)C1CCCN1 |
| InChI | InChI=1S/C12H15NO2.C3H7NO2/c14-12(11-7-4-8-13-11)15-9-10-5-2-1-3-6-10;1-2(4)3(5)6/h1-3,5-6,11,13H,4,7-9H2;2H,4H2,1H3,(H,5,6) |
| InChIKey | QUVWNJWWKCVQNM-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |