C14H19NO2 — CID 788180
benzyl (2R,6S)-6-methylpiperidine-2-carboxylate (PubChem CID 788180) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is benzyl (2R,6S)-6-methylpiperidine-2-carboxylate.
| Compound Name | benzyl (2R,6S)-6-methylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 788180 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | benzyl (2R,6S)-6-methylpiperidine-2-carboxylate |
| SMILES | C[C@H]1CCC[C@H](C(=O)OCc2ccccc2)N1 |
| InChI | InChI=1S/C14H19NO2/c1-11-6-5-9-13(15-11)14(16)17-10-12-7-3-2-4-8-12/h2-4,7-8,11,13,15H,5-6,9-10H2,1H3/t11-,13+/m0/s1 |
| InChIKey | VCDXZKWEOAGDCL-WCQYABFASA-N |
| XLogP | 2.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |