C21H28N2O5 — CID 135315135
[2-cyclohexyl-2-(phenylmethoxycarbonylamino)acetyl] (2S)-pyrrolidine-2-carboxylate (PubChem CID 135315135) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is [2-cyclohexyl-2-(phenylmethoxycarbonylamino)acetyl] (2S)-pyrrolidine-2-carboxylate.
| Compound Name | [2-cyclohexyl-2-(phenylmethoxycarbonylamino)acetyl] (2S)-pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 135315135 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | [2-cyclohexyl-2-(phenylmethoxycarbonylamino)acetyl] (2S)-pyrrolidine-2-carboxylate |
| SMILES | O=C(NC(C(=O)OC(=O)[C@@H]1CCCN1)C1CCCCC1)OCc1ccccc1 |
| InChI | InChI=1S/C21H28N2O5/c24-19(17-12-7-13-22-17)28-20(25)18(16-10-5-2-6-11-16)23-21(26)27-14-15-8-3-1-4-9-15/h1,3-4,8-9,16-18,22H,2,5-7,10-14H2,(H,23,26)/t17-,18?/m0/s1 |
| InChIKey | FIBPGIDAYUXATD-ZENAZSQFSA-N |
| XLogP | 2.68 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|