C22H24N2O6 — CID 18954401
(4-nitrophenyl) 2-cyclohexyl-2-(phenylmethoxycarbonylamino)acetate (PubChem CID 18954401) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is (4-nitrophenyl) 2-cyclohexyl-2-(phenylmethoxycarbonylamino)acetate.
| Compound Name | (4-nitrophenyl) 2-cyclohexyl-2-(phenylmethoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 18954401 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | (4-nitrophenyl) 2-cyclohexyl-2-(phenylmethoxycarbonylamino)acetate |
| SMILES | O=C(NC(C(=O)Oc1ccc([N+](=O)[O-])cc1)C1CCCCC1)OCc1ccccc1 |
| InChI | InChI=1S/C22H24N2O6/c25-21(30-19-13-11-18(12-14-19)24(27)28)20(17-9-5-2-6-10-17)23-22(26)29-15-16-7-3-1-4-8-16/h1,3-4,7-8,11-14,17,20H,2,5-6,9-10,15H2,(H,23,26) |
| InChIKey | DZBWHLLLEWZXQH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|