C22H27N2O7P — CID 175315244
ethyl 2-cyclohexyl-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]acetate (PubChem CID 175315244) has the molecular formula C22H27N2O7P and a molecular weight of 462.44 g/mol. Its IUPAC name is ethyl 2-cyclohexyl-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]acetate.
| Compound Name | ethyl 2-cyclohexyl-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]acetate |
|---|---|
| PubChem CID | 175315244 |
| Molecular Formula | C22H27N2O7P |
| Molecular Weight | 462.44 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | ethyl 2-cyclohexyl-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]acetate |
| SMILES | CCOC(=O)C(NP(=O)(Oc1ccccc1)Oc1ccc([N+](=O)[O-])cc1)C1CCCCC1 |
| InChI | InChI=1S/C22H27N2O7P/c1-2-29-22(25)21(17-9-5-3-6-10-17)23-32(28,30-19-11-7-4-8-12-19)31-20-15-13-18(14-16-20)24(26)27/h4,7-8,11-17,21H,2-3,5-6,9-10H2,1H3,(H,23,28) |
| InChIKey | OQVHWHBFPDMKDB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.44 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|