C20H23N2O7P — CID 166063088
(2S)-2-cyclohexyl-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]acetic acid (PubChem CID 166063088) has the molecular formula C20H23N2O7P and a molecular weight of 434.39 g/mol. Its IUPAC name is (2S)-2-cyclohexyl-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]acetic acid.
| Compound Name | (2S)-2-cyclohexyl-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]acetic acid |
|---|---|
| PubChem CID | 166063088 |
| Molecular Formula | C20H23N2O7P |
| Molecular Weight | 434.39 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | (2S)-2-cyclohexyl-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]acetic acid |
| SMILES | O=C(O)[C@@H](NP(=O)(Oc1ccccc1)Oc1ccc([N+](=O)[O-])cc1)C1CCCCC1 |
| InChI | InChI=1S/C20H23N2O7P/c23-20(24)19(15-7-3-1-4-8-15)21-30(27,28-17-9-5-2-6-10-17)29-18-13-11-16(12-14-18)22(25)26/h2,5-6,9-15,19H,1,3-4,7-8H2,(H,21,27)(H,23,24)/t19-,30?/m0/s1 |
| InChIKey | OSEJYNGBWYOQFX-QUZMYUOTSA-N |
| XLogP | 4.78 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.39 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|