C16H15N2O7P — CID 175315225
[[(4-nitrophenoxy)-phenoxyphosphoryl]amino] cyclopropanecarboxylate (PubChem CID 175315225) has the molecular formula C16H15N2O7P and a molecular weight of 378.28 g/mol. Its IUPAC name is [[(4-nitrophenoxy)-phenoxyphosphoryl]amino] cyclopropanecarboxylate.
| Compound Name | [[(4-nitrophenoxy)-phenoxyphosphoryl]amino] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 175315225 |
| Molecular Formula | C16H15N2O7P |
| Molecular Weight | 378.28 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | [[(4-nitrophenoxy)-phenoxyphosphoryl]amino] cyclopropanecarboxylate |
| SMILES | O=C(ONP(=O)(Oc1ccccc1)Oc1ccc([N+](=O)[O-])cc1)C1CC1 |
| InChI | InChI=1S/C16H15N2O7P/c19-16(12-6-7-12)23-17-26(22,24-14-4-2-1-3-5-14)25-15-10-8-13(9-11-15)18(20)21/h1-5,8-12H,6-7H2,(H,17,22) |
| InChIKey | OTTQJMJUPNMSKV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.28 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|