C17H19N3O6 — CID 88676033
[2-oxo-3-(phenylmethoxycarbonylamino)azetidine-1-carbonyl] (2R)-pyrrolidine-2-carboxylate (PubChem CID 88676033) has the molecular formula C17H19N3O6 and a molecular weight of 361.35 g/mol. Its IUPAC name is [2-oxo-3-(phenylmethoxycarbonylamino)azetidine-1-carbonyl] (2R)-pyrrolidine-2-carboxylate.
| Compound Name | [2-oxo-3-(phenylmethoxycarbonylamino)azetidine-1-carbonyl] (2R)-pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 88676033 |
| Molecular Formula | C17H19N3O6 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | [2-oxo-3-(phenylmethoxycarbonylamino)azetidine-1-carbonyl] (2R)-pyrrolidine-2-carboxylate |
| SMILES | O=C(NC1CN(C(=O)OC(=O)[C@H]2CCCN2)C1=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H19N3O6/c21-14-13(19-16(23)25-10-11-5-2-1-3-6-11)9-20(14)17(24)26-15(22)12-7-4-8-18-12/h1-3,5-6,12-13,18H,4,7-10H2,(H,19,23)/t12-,13?/m1/s1 |
| InChIKey | BEVZBWJWLGPXDS-PZORYLMUSA-N |
| XLogP | 0.54 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|