C19H25N5O4 — CID 10318037
benzyl (NE)-N-[amino-[(3S)-2-oxo-3-[[(2S)-pyrrolidine-2-carbonyl]amino]piperidin-1-yl]methylidene]carbamate (PubChem CID 10318037) has the molecular formula C19H25N5O4 and a molecular weight of 387.44 g/mol. Its IUPAC name is benzyl (NE)-N-[amino-[(3S)-2-oxo-3-[[(2S)-pyrrolidine-2-carbonyl]amino]piperidin-1-yl]methylidene]carbamate.
| Compound Name | benzyl (NE)-N-[amino-[(3S)-2-oxo-3-[[(2S)-pyrrolidine-2-carbonyl]amino]piperidin-1-yl]methylidene]carbamate |
|---|---|
| PubChem CID | 10318037 |
| Molecular Formula | C19H25N5O4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | benzyl (NE)-N-[amino-[(3S)-2-oxo-3-[[(2S)-pyrrolidine-2-carbonyl]amino]piperidin-1-yl]methylidene]carbamate |
| SMILES | N/C(=N\C(=O)OCc1ccccc1)N1CCC[C@H](NC(=O)[C@@H]2CCCN2)C1=O |
| InChI | InChI=1S/C19H25N5O4/c20-18(23-19(27)28-12-13-6-2-1-3-7-13)24-11-5-9-15(17(24)26)22-16(25)14-8-4-10-21-14/h1-3,6-7,14-15,21H,4-5,8-12H2,(H,22,25)(H2,20,23,27)/t14-,15-/m0/s1 |
| InChIKey | IVFWFWFWCYQSQQ-GJZGRUSLSA-N |
| XLogP | 0.50 |
| TPSA | 126.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|