C27H32N6O5 — CID 10414328
benzyl (NE)-N-[amino-[(3S)-2-oxo-3-[[(2S)-1-(3-pyridin-3-ylpropanoyl)pyrrolidine-2-carbonyl]amino]piperidin-1-yl]methylidene]carbamate (PubChem CID 10414328) has the molecular formula C27H32N6O5 and a molecular weight of 520.59 g/mol. Its IUPAC name is benzyl (NE)-N-[amino-[(3S)-2-oxo-3-[[(2S)-1-(3-pyridin-3-ylpropanoyl)pyrrolidine-2-carbonyl]amino]piperidin-1-yl]methylidene]carbamate.
| Compound Name | benzyl (NE)-N-[amino-[(3S)-2-oxo-3-[[(2S)-1-(3-pyridin-3-ylpropanoyl)pyrrolidine-2-carbonyl]amino]piperidin-1-yl]methylidene]carbamate |
|---|---|
| PubChem CID | 10414328 |
| Molecular Formula | C27H32N6O5 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | benzyl (NE)-N-[amino-[(3S)-2-oxo-3-[[(2S)-1-(3-pyridin-3-ylpropanoyl)pyrrolidine-2-carbonyl]amino]piperidin-1-yl]methylidene]carbamate |
| SMILES | N/C(=N\C(=O)OCc1ccccc1)N1CCC[C@H](NC(=O)[C@@H]2CCCN2C(=O)CCc2cccnc2)C1=O |
| InChI | InChI=1S/C27H32N6O5/c28-26(31-27(37)38-18-20-7-2-1-3-8-20)33-16-5-10-21(25(33)36)30-24(35)22-11-6-15-32(22)23(34)13-12-19-9-4-14-29-17-19/h1-4,7-9,14,17,21-22H,5-6,10-13,15-16,18H2,(H,30,35)(H2,28,31,37)/t21-,22-/m0/s1 |
| InChIKey | IKCKUWZZPDGOON-VXKWHMMOSA-N |
| XLogP | 1.76 |
| TPSA | 147.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|