C17H23N3O4 — CID 22814959
benzyl (4R)-5-amino-5-oxo-4-[[(2S)-pyrrolidine-2-carbonyl]amino]pentanoate (PubChem CID 22814959) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is benzyl (4R)-5-amino-5-oxo-4-[[(2S)-pyrrolidine-2-carbonyl]amino]pentanoate.
| Compound Name | benzyl (4R)-5-amino-5-oxo-4-[[(2S)-pyrrolidine-2-carbonyl]amino]pentanoate |
|---|---|
| PubChem CID | 22814959 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | benzyl (4R)-5-amino-5-oxo-4-[[(2S)-pyrrolidine-2-carbonyl]amino]pentanoate |
| SMILES | NC(=O)[C@@H](CCC(=O)OCc1ccccc1)NC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C17H23N3O4/c18-16(22)13(20-17(23)14-7-4-10-19-14)8-9-15(21)24-11-12-5-2-1-3-6-12/h1-3,5-6,13-14,19H,4,7-11H2,(H2,18,22)(H,20,23)/t13-,14+/m1/s1 |
| InChIKey | NSVYUZMZBVAEGD-KGLIPLIRSA-N |
| XLogP | 0.23 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |