C11H13N2NaO6S — CID 173435022
sodium;hydride;2-oxo-3-(phenylmethoxycarbonylamino)azetidine-1-sulfonic acid (PubChem CID 173435022) has the molecular formula C11H13N2NaO6S and a molecular weight of 324.29 g/mol. Its IUPAC name is sodium;hydride;2-oxo-3-(phenylmethoxycarbonylamino)azetidine-1-sulfonic acid.
| Compound Name | sodium;hydride;2-oxo-3-(phenylmethoxycarbonylamino)azetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 173435022 |
| Molecular Formula | C11H13N2NaO6S |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | sodium;hydride;2-oxo-3-(phenylmethoxycarbonylamino)azetidine-1-sulfonic acid |
| SMILES | O=C(NC1CN(S(=O)(=O)O)C1=O)OCc1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C11H12N2O6S.Na.H/c14-10-9(6-13(10)20(16,17)18)12-11(15)19-7-8-4-2-1-3-5-8;;/h1-5,9H,6-7H2,(H,12,15)(H,16,17,18);;/q;+1;-1 |
| InChIKey | CXBPHQWCEGGLQK-UHFFFAOYSA-N |
| XLogP | -2.96 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|