C17H22N2O3 — CID 67755202
benzyl (3S)-1-[(2S)-pyrrolidine-2-carbonyl]pyrrolidine-3-carboxylate (PubChem CID 67755202) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is benzyl (3S)-1-[(2S)-pyrrolidine-2-carbonyl]pyrrolidine-3-carboxylate.
| Compound Name | benzyl (3S)-1-[(2S)-pyrrolidine-2-carbonyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 67755202 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | benzyl (3S)-1-[(2S)-pyrrolidine-2-carbonyl]pyrrolidine-3-carboxylate |
| SMILES | O=C(OCc1ccccc1)[C@H]1CCN(C(=O)[C@@H]2CCCN2)C1 |
| InChI | InChI=1S/C17H22N2O3/c20-16(15-7-4-9-18-15)19-10-8-14(11-19)17(21)22-12-13-5-2-1-3-6-13/h1-3,5-6,14-15,18H,4,7-12H2/t14-,15-/m0/s1 |
| InChIKey | YMRJZQDNFDQKPI-GJZGRUSLSA-N |
| XLogP | 1.33 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |