About (4-fluorophenyl)methyl (2S)-pyrrolidine-2-carboxylate
(4-fluorophenyl)methyl (2S)-pyrrolidine-2-carboxylate (PubChem CID 94259086) has the molecular formula C12H14FNO2
and a molecular weight of 223.25 g/mol. Its IUPAC name is (4-fluorophenyl)methyl (2S)-pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | (4-fluorophenyl)methyl (2S)-pyrrolidine-2-carboxylate |
| PubChem CID | 94259086 |
| Molecular Formula | C12H14FNO2 |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | (4-fluorophenyl)methyl (2S)-pyrrolidine-2-carboxylate |
| SMILES | O=C(OCc1ccc(F)cc1)[C@@H]1CCCN1 |
| InChI | InChI=1S/C12H14FNO2/c13-10-5-3-9(4-6-10)8-16-12(15)11-2-1-7-14-11/h3-6,11,14H,1-2,7-8H2/t11-/m0/s1 |
| InChIKey | OUIWEHUVELZDIM-NSHDSACASA-N |
| XLogP | 1.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-fluorophenyl)methyl (2S)-pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorophenyl)methyl (2S)-pyrrolidine-2-carboxylate?
The IUPAC name of (4-fluorophenyl)methyl (2S)-pyrrolidine-2-carboxylate (CID 94259086) is (4-fluorophenyl)methyl (2S)-pyrrolidine-2-carboxylate.
What is the SMILES notation for (4-fluorophenyl)methyl (2S)-pyrrolidine-2-carboxylate?
The canonical SMILES for (4-fluorophenyl)methyl (2S)-pyrrolidine-2-carboxylate is O=C(OCc1ccc(F)cc1)[C@@H]1CCCN1.
What is the InChIKey of (4-fluorophenyl)methyl (2S)-pyrrolidine-2-carboxylate?
The InChIKey is OUIWEHUVELZDIM-NSHDSACASA-N. The full InChI is InChI=1S/C12H14FNO2/c13-10-5-3-9(4-6-10)8-16-12(15)11-2-1-7-14-11/h3-6,11,14H,1-2,7-8H2/t11-/m0/s1.
What are the key properties of (4-fluorophenyl)methyl (2S)-pyrrolidine-2-carboxylate?
(4-fluorophenyl)methyl (2S)-pyrrolidine-2-carboxylate has a molecular weight of 223.25 g/mol, XLogP of 1.62, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl)methyl (2S)-pyrrolidine-2-carboxylate is sourced from PubChem (CID 94259086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).