C13H16N2O4 — CID 45072529
(2S,4S)-4-(phenylmethoxycarbonylamino)pyrrolidine-2-carboxylic acid (PubChem CID 45072529) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is (2S,4S)-4-(phenylmethoxycarbonylamino)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-4-(phenylmethoxycarbonylamino)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 45072529 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | (2S,4S)-4-(phenylmethoxycarbonylamino)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(N[C@@H]1CN[C@H](C(=O)O)C1)OCc1ccccc1 |
| InChI | InChI=1S/C13H16N2O4/c16-12(17)11-6-10(7-14-11)15-13(18)19-8-9-4-2-1-3-5-9/h1-5,10-11,14H,6-8H2,(H,15,18)(H,16,17)/t10-,11-/m0/s1 |
| InChIKey | VCZIKOUKWSDDIU-QWRGUYRKSA-N |
| XLogP | 0.73 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |