C18H27NO7S — CID 174205880
4-[2-[3-(4-methylphenyl)sulfonyloxypropoxy]ethoxy]piperidine-1-carboxylic acid (PubChem CID 174205880) has the molecular formula C18H27NO7S and a molecular weight of 401.48 g/mol. Its IUPAC name is 4-[2-[3-(4-methylphenyl)sulfonyloxypropoxy]ethoxy]piperidine-1-carboxylic acid.
| Compound Name | 4-[2-[3-(4-methylphenyl)sulfonyloxypropoxy]ethoxy]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 174205880 |
| Molecular Formula | C18H27NO7S |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 4-[2-[3-(4-methylphenyl)sulfonyloxypropoxy]ethoxy]piperidine-1-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)OCCCOCCOC2CCN(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C18H27NO7S/c1-15-3-5-17(6-4-15)27(22,23)26-12-2-11-24-13-14-25-16-7-9-19(10-8-16)18(20)21/h3-6,16H,2,7-14H2,1H3,(H,20,21) |
| InChIKey | BCSJMYDIDZGUQI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|