C27H44O9S — CID 87549216
ethyl 4-(methoxymethoxy)cyclohexane-1-carboxylate;[4-(methoxymethoxy)cyclohexyl]methyl 4-methylbenzenesulfonate (PubChem CID 87549216) has the molecular formula C27H44O9S and a molecular weight of 544.71 g/mol. Its IUPAC name is ethyl 4-(methoxymethoxy)cyclohexane-1-carboxylate;[4-(methoxymethoxy)cyclohexyl]methyl 4-methylbenzenesulfonate.
| Compound Name | ethyl 4-(methoxymethoxy)cyclohexane-1-carboxylate;[4-(methoxymethoxy)cyclohexyl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87549216 |
| Molecular Formula | C27H44O9S |
| Molecular Weight | 544.71 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | ethyl 4-(methoxymethoxy)cyclohexane-1-carboxylate;[4-(methoxymethoxy)cyclohexyl]methyl 4-methylbenzenesulfonate |
| SMILES | CCOC(=O)C1CCC(OCOC)CC1.COCOC1CCC(COS(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C16H24O5S.C11H20O4/c1-13-3-9-16(10-4-13)22(17,18)21-11-14-5-7-15(8-6-14)20-12-19-2;1-3-14-11(12)9-4-6-10(7-5-9)15-8-13-2/h3-4,9-10,14-15H,5-8,11-12H2,1-2H3;9-10H,3-8H2,1-2H3 |
| InChIKey | UMJFJWFTIMWMIS-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.71 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|