C16H21NO5S — CID 86678799
ethyl 4-(4-methylphenyl)sulfonyloxyiminocyclohexane-1-carboxylate (PubChem CID 86678799) has the molecular formula C16H21NO5S and a molecular weight of 339.41 g/mol. Its IUPAC name is ethyl 4-(4-methylphenyl)sulfonyloxyiminocyclohexane-1-carboxylate.
| Compound Name | ethyl 4-(4-methylphenyl)sulfonyloxyiminocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 86678799 |
| Molecular Formula | C16H21NO5S |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | ethyl 4-(4-methylphenyl)sulfonyloxyiminocyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(=NOS(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C16H21NO5S/c1-3-21-16(18)13-6-8-14(9-7-13)17-22-23(19,20)15-10-4-12(2)5-11-15/h4-5,10-11,13H,3,6-9H2,1-2H3/b17-14- |
| InChIKey | WEOCFGGJSXETBB-VKAVYKQESA-N |
| XLogP | 2.81 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|