C16H24O5S — CID 87549085
[4-(methoxymethoxy)cyclohexyl]methyl 4-methylbenzenesulfonate (PubChem CID 87549085) has the molecular formula C16H24O5S and a molecular weight of 328.43 g/mol. Its IUPAC name is [4-(methoxymethoxy)cyclohexyl]methyl 4-methylbenzenesulfonate.
| Compound Name | [4-(methoxymethoxy)cyclohexyl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87549085 |
| Molecular Formula | C16H24O5S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | [4-(methoxymethoxy)cyclohexyl]methyl 4-methylbenzenesulfonate |
| SMILES | COCOC1CCC(COS(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C16H24O5S/c1-13-3-9-16(10-4-13)22(17,18)21-11-14-5-7-15(8-6-14)20-12-19-2/h3-4,9-10,14-15H,5-8,11-12H2,1-2H3 |
| InChIKey | MPXVLWCTAZJHEY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|