C14H17F3O3S — CID 134842633
[(1S,3S)-3-(trifluoromethyl)cyclopentyl]methyl 4-methylbenzenesulfonate (PubChem CID 134842633) has the molecular formula C14H17F3O3S and a molecular weight of 322.35 g/mol. Its IUPAC name is [(1S,3S)-3-(trifluoromethyl)cyclopentyl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(1S,3S)-3-(trifluoromethyl)cyclopentyl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134842633 |
| Molecular Formula | C14H17F3O3S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | [(1S,3S)-3-(trifluoromethyl)cyclopentyl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2CC[C@H](C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C14H17F3O3S/c1-10-2-6-13(7-3-10)21(18,19)20-9-11-4-5-12(8-11)14(15,16)17/h2-3,6-7,11-12H,4-5,8-9H2,1H3/t11-,12-/m0/s1 |
| InChIKey | FNVOURUNFIFRKK-RYUDHWBXSA-N |
| XLogP | 3.68 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|