C15H23NO3S — CID 76763610
(1,6-dimethylpiperidin-3-yl)methyl 4-methylbenzenesulfonate (PubChem CID 76763610) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is (1,6-dimethylpiperidin-3-yl)methyl 4-methylbenzenesulfonate.
| Compound Name | (1,6-dimethylpiperidin-3-yl)methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 76763610 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (1,6-dimethylpiperidin-3-yl)methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CCC(C)N(C)C2)cc1 |
| InChI | InChI=1S/C15H23NO3S/c1-12-4-8-15(9-5-12)20(17,18)19-11-14-7-6-13(2)16(3)10-14/h4-5,8-9,13-14H,6-7,10-11H2,1-3H3 |
| InChIKey | JFVFDBVCVSQJHO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|