C13H16O4S — CID 129316710
6-oxabicyclo[3.1.0]hexan-3-ylmethyl 4-methylbenzenesulfonate (PubChem CID 129316710) has the molecular formula C13H16O4S and a molecular weight of 268.33 g/mol. Its IUPAC name is 6-oxabicyclo[3.1.0]hexan-3-ylmethyl 4-methylbenzenesulfonate.
| Compound Name | 6-oxabicyclo[3.1.0]hexan-3-ylmethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 129316710 |
| Molecular Formula | C13H16O4S |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 6-oxabicyclo[3.1.0]hexan-3-ylmethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CC3OC3C2)cc1 |
| InChI | InChI=1S/C13H16O4S/c1-9-2-4-11(5-3-9)18(14,15)16-8-10-6-12-13(7-10)17-12/h2-5,10,12-13H,6-8H2,1H3 |
| InChIKey | FKCDDERSDRSUEM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|