C22H37FN4O4S — CID 174628087
tert-butyl formate;N-[2-fluoro-4-[(4-methylsulfonylpiperazin-1-yl)methyl]phenyl]piperidin-4-amine (PubChem CID 174628087) has the molecular formula C22H37FN4O4S and a molecular weight of 472.63 g/mol. Its IUPAC name is tert-butyl formate;N-[2-fluoro-4-[(4-methylsulfonylpiperazin-1-yl)methyl]phenyl]piperidin-4-amine.
| Compound Name | tert-butyl formate;N-[2-fluoro-4-[(4-methylsulfonylpiperazin-1-yl)methyl]phenyl]piperidin-4-amine |
|---|---|
| PubChem CID | 174628087 |
| Molecular Formula | C22H37FN4O4S |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | tert-butyl formate;N-[2-fluoro-4-[(4-methylsulfonylpiperazin-1-yl)methyl]phenyl]piperidin-4-amine |
| SMILES | CC(C)(C)OC=O.CS(=O)(=O)N1CCN(Cc2ccc(NC3CCNCC3)c(F)c2)CC1 |
| InChI | InChI=1S/C17H27FN4O2S.C5H10O2/c1-25(23,24)22-10-8-21(9-11-22)13-14-2-3-17(16(18)12-14)20-15-4-6-19-7-5-15;1-5(2,3)7-4-6/h2-3,12,15,19-20H,4-11,13H2,1H3;4H,1-3H3 |
| InChIKey | LEOAOZPXGUOHJB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|