C18H28N2O3S — CID 91773142
1-[(4-cyclopentyloxyphenyl)methyl]-4-methylsulfonyl-1,4-diazepane (PubChem CID 91773142) has the molecular formula C18H28N2O3S and a molecular weight of 352.50 g/mol. Its IUPAC name is 1-[(4-cyclopentyloxyphenyl)methyl]-4-methylsulfonyl-1,4-diazepane.
| Compound Name | 1-[(4-cyclopentyloxyphenyl)methyl]-4-methylsulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 91773142 |
| Molecular Formula | C18H28N2O3S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 1-[(4-cyclopentyloxyphenyl)methyl]-4-methylsulfonyl-1,4-diazepane |
| SMILES | CS(=O)(=O)N1CCCN(Cc2ccc(OC3CCCC3)cc2)CC1 |
| InChI | InChI=1S/C18H28N2O3S/c1-24(21,22)20-12-4-11-19(13-14-20)15-16-7-9-18(10-8-16)23-17-5-2-3-6-17/h7-10,17H,2-6,11-15H2,1H3 |
| InChIKey | RMSPJSLSHMUNDS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |