C21H32N2O2 — CID 92641147
4-[(3R)-1-[(4-cyclopentyloxyphenyl)methyl]piperidin-3-yl]morpholine (PubChem CID 92641147) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is 4-[(3R)-1-[(4-cyclopentyloxyphenyl)methyl]piperidin-3-yl]morpholine.
| Compound Name | 4-[(3R)-1-[(4-cyclopentyloxyphenyl)methyl]piperidin-3-yl]morpholine |
|---|---|
| PubChem CID | 92641147 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | 4-[(3R)-1-[(4-cyclopentyloxyphenyl)methyl]piperidin-3-yl]morpholine |
| SMILES | c1cc(OC2CCCC2)ccc1CN1CCC[C@@H](N2CCOCC2)C1 |
| InChI | InChI=1S/C21H32N2O2/c1-2-6-20(5-1)25-21-9-7-18(8-10-21)16-22-11-3-4-19(17-22)23-12-14-24-15-13-23/h7-10,19-20H,1-6,11-17H2/t19-/m1/s1 |
| InChIKey | ZTWVNFUJGGIVHQ-LJQANCHMSA-N |
| XLogP | 3.30 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |