C21H32N2O3 — CID 31015761
(3R,4R)-1-[(4-cyclopentyloxyphenyl)methyl]-4-morpholin-4-ylpiperidin-3-ol (PubChem CID 31015761) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is (3R,4R)-1-[(4-cyclopentyloxyphenyl)methyl]-4-morpholin-4-ylpiperidin-3-ol.
| Compound Name | (3R,4R)-1-[(4-cyclopentyloxyphenyl)methyl]-4-morpholin-4-ylpiperidin-3-ol |
|---|---|
| PubChem CID | 31015761 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | (3R,4R)-1-[(4-cyclopentyloxyphenyl)methyl]-4-morpholin-4-ylpiperidin-3-ol |
| SMILES | O[C@@H]1CN(Cc2ccc(OC3CCCC3)cc2)CC[C@H]1N1CCOCC1 |
| InChI | InChI=1S/C21H32N2O3/c24-21-16-22(10-9-20(21)23-11-13-25-14-12-23)15-17-5-7-19(8-6-17)26-18-3-1-2-4-18/h5-8,18,20-21,24H,1-4,9-16H2/t20-,21-/m1/s1 |
| InChIKey | RSDCREQZPJJIPV-NHCUHLMSSA-N |
| XLogP | 2.28 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |