C20H29N3O3 — CID 45244684
(3R,4R)-1-[(5-methoxy-3-methyl-1H-indol-2-yl)methyl]-4-morpholin-4-ylpiperidin-3-ol (PubChem CID 45244684) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is (3R,4R)-1-[(5-methoxy-3-methyl-1H-indol-2-yl)methyl]-4-morpholin-4-ylpiperidin-3-ol.
| Compound Name | (3R,4R)-1-[(5-methoxy-3-methyl-1H-indol-2-yl)methyl]-4-morpholin-4-ylpiperidin-3-ol |
|---|---|
| PubChem CID | 45244684 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | (3R,4R)-1-[(5-methoxy-3-methyl-1H-indol-2-yl)methyl]-4-morpholin-4-ylpiperidin-3-ol |
| SMILES | COc1ccc2[nH]c(CN3CC[C@@H](N4CCOCC4)[C@H](O)C3)c(C)c2c1 |
| InChI | InChI=1S/C20H29N3O3/c1-14-16-11-15(25-2)3-4-17(16)21-18(14)12-22-6-5-19(20(24)13-22)23-7-9-26-10-8-23/h3-4,11,19-21,24H,5-10,12-13H2,1-2H3/t19-,20-/m1/s1 |
| InChIKey | RTBDRGFKMPQUQQ-WOJBJXKFSA-N |
| XLogP | 1.75 |
| TPSA | 60.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|