C19H26ClN3O2 — CID 29256663
(3R,4R)-1-[(7-chloro-3-methyl-1H-indol-2-yl)methyl]-4-morpholin-4-ylpiperidin-3-ol (PubChem CID 29256663) has the molecular formula C19H26ClN3O2 and a molecular weight of 363.89 g/mol. Its IUPAC name is (3R,4R)-1-[(7-chloro-3-methyl-1H-indol-2-yl)methyl]-4-morpholin-4-ylpiperidin-3-ol.
| Compound Name | (3R,4R)-1-[(7-chloro-3-methyl-1H-indol-2-yl)methyl]-4-morpholin-4-ylpiperidin-3-ol |
|---|---|
| PubChem CID | 29256663 |
| Molecular Formula | C19H26ClN3O2 |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | (3R,4R)-1-[(7-chloro-3-methyl-1H-indol-2-yl)methyl]-4-morpholin-4-ylpiperidin-3-ol |
| SMILES | Cc1c(CN2CC[C@@H](N3CCOCC3)[C@H](O)C2)[nH]c2c(Cl)cccc12 |
| InChI | InChI=1S/C19H26ClN3O2/c1-13-14-3-2-4-15(20)19(14)21-16(13)11-22-6-5-17(18(24)12-22)23-7-9-25-10-8-23/h2-4,17-18,21,24H,5-12H2,1H3/t17-,18-/m1/s1 |
| InChIKey | ICTZMQPANPFLPG-QZTJIDSGSA-N |
| XLogP | 2.40 |
| TPSA | 51.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|