C20H28FN3O2 — CID 25385611
(3R,4R)-1-[(5-fluoro-3-methyl-1H-indol-2-yl)methyl]-4-(4-hydroxypiperidin-1-yl)piperidin-3-ol (PubChem CID 25385611) has the molecular formula C20H28FN3O2 and a molecular weight of 361.46 g/mol. Its IUPAC name is (3R,4R)-1-[(5-fluoro-3-methyl-1H-indol-2-yl)methyl]-4-(4-hydroxypiperidin-1-yl)piperidin-3-ol.
| Compound Name | (3R,4R)-1-[(5-fluoro-3-methyl-1H-indol-2-yl)methyl]-4-(4-hydroxypiperidin-1-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 25385611 |
| Molecular Formula | C20H28FN3O2 |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | (3R,4R)-1-[(5-fluoro-3-methyl-1H-indol-2-yl)methyl]-4-(4-hydroxypiperidin-1-yl)piperidin-3-ol |
| SMILES | Cc1c(CN2CC[C@@H](N3CCC(O)CC3)[C@H](O)C2)[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C20H28FN3O2/c1-13-16-10-14(21)2-3-17(16)22-18(13)11-23-7-6-19(20(26)12-23)24-8-4-15(25)5-9-24/h2-3,10,15,19-20,22,25-26H,4-9,11-12H2,1H3/t19-,20-/m1/s1 |
| InChIKey | PFUGDOQIUUGYAM-WOJBJXKFSA-N |
| XLogP | 2.01 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|