C19H18F2N2O — CID 77092135
5-fluoro-2-[[3-(2-fluorophenoxy)azetidin-1-yl]methyl]-3-methyl-1H-indole (PubChem CID 77092135) has the molecular formula C19H18F2N2O and a molecular weight of 328.36 g/mol. Its IUPAC name is 5-fluoro-2-[[3-(2-fluorophenoxy)azetidin-1-yl]methyl]-3-methyl-1H-indole.
| Compound Name | 5-fluoro-2-[[3-(2-fluorophenoxy)azetidin-1-yl]methyl]-3-methyl-1H-indole |
|---|---|
| PubChem CID | 77092135 |
| Molecular Formula | C19H18F2N2O |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 5-fluoro-2-[[3-(2-fluorophenoxy)azetidin-1-yl]methyl]-3-methyl-1H-indole |
| SMILES | Cc1c(CN2CC(Oc3ccccc3F)C2)[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C19H18F2N2O/c1-12-15-8-13(20)6-7-17(15)22-18(12)11-23-9-14(10-23)24-19-5-3-2-4-16(19)21/h2-8,14,22H,9-11H2,1H3 |
| InChIKey | ACYRKWPIFMYTCW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|