C19H26N2O2 — CID 74241751
5-methoxy-2-[[(1R,5S)-8-methoxy-3-azabicyclo[3.2.1]octan-3-yl]methyl]-3-methyl-1H-indole (PubChem CID 74241751) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 5-methoxy-2-[[(1R,5S)-8-methoxy-3-azabicyclo[3.2.1]octan-3-yl]methyl]-3-methyl-1H-indole.
| Compound Name | 5-methoxy-2-[[(1R,5S)-8-methoxy-3-azabicyclo[3.2.1]octan-3-yl]methyl]-3-methyl-1H-indole |
|---|---|
| PubChem CID | 74241751 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 5-methoxy-2-[[(1R,5S)-8-methoxy-3-azabicyclo[3.2.1]octan-3-yl]methyl]-3-methyl-1H-indole |
| SMILES | COc1ccc2[nH]c(CN3C[C@H]4CC[C@@H](C3)C4OC)c(C)c2c1 |
| InChI | InChI=1S/C19H26N2O2/c1-12-16-8-15(22-2)6-7-17(16)20-18(12)11-21-9-13-4-5-14(10-21)19(13)23-3/h6-8,13-14,19-20H,4-5,9-11H2,1-3H3/t13-,14+,19? |
| InChIKey | GODGVOVMCMGASU-FSWDVZBNSA-N |
| XLogP | 3.34 |
| TPSA | 37.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|