C19H25N5O — CID 99931901
5-methoxy-3-methyl-2-[[(3R)-3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]methyl]-1H-indole (PubChem CID 99931901) has the molecular formula C19H25N5O and a molecular weight of 339.44 g/mol. Its IUPAC name is 5-methoxy-3-methyl-2-[[(3R)-3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]methyl]-1H-indole.
| Compound Name | 5-methoxy-3-methyl-2-[[(3R)-3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]methyl]-1H-indole |
|---|---|
| PubChem CID | 99931901 |
| Molecular Formula | C19H25N5O |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | 5-methoxy-3-methyl-2-[[(3R)-3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]methyl]-1H-indole |
| SMILES | COc1ccc2[nH]c(CN3CCC[C@@H](c4n[nH]c(C)n4)C3)c(C)c2c1 |
| InChI | InChI=1S/C19H25N5O/c1-12-16-9-15(25-3)6-7-17(16)21-18(12)11-24-8-4-5-14(10-24)19-20-13(2)22-23-19/h6-7,9,14,21H,4-5,8,10-11H2,1-3H3,(H,20,22,23)/t14-/m1/s1 |
| InChIKey | BYOLXHLZKGISIA-CQSZACIVSA-N |
| XLogP | 3.29 |
| TPSA | 69.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|