C24H29F2N3O2 — CID 45215915
2-[1-[(3,4-difluorophenyl)methyl]-4-[(5-methoxy-3-methyl-1H-indol-2-yl)methyl]piperazin-2-yl]ethanol (PubChem CID 45215915) has the molecular formula C24H29F2N3O2 and a molecular weight of 429.51 g/mol. Its IUPAC name is 2-[1-[(3,4-difluorophenyl)methyl]-4-[(5-methoxy-3-methyl-1H-indol-2-yl)methyl]piperazin-2-yl]ethanol.
| Compound Name | 2-[1-[(3,4-difluorophenyl)methyl]-4-[(5-methoxy-3-methyl-1H-indol-2-yl)methyl]piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 45215915 |
| Molecular Formula | C24H29F2N3O2 |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 2-[1-[(3,4-difluorophenyl)methyl]-4-[(5-methoxy-3-methyl-1H-indol-2-yl)methyl]piperazin-2-yl]ethanol |
| SMILES | COc1ccc2[nH]c(CN3CCN(Cc4ccc(F)c(F)c4)C(CCO)C3)c(C)c2c1 |
| InChI | InChI=1S/C24H29F2N3O2/c1-16-20-12-19(31-2)4-6-23(20)27-24(16)15-28-8-9-29(18(14-28)7-10-30)13-17-3-5-21(25)22(26)11-17/h3-6,11-12,18,27,30H,7-10,13-15H2,1-2H3 |
| InChIKey | HQDDULPFRDGCDJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 51.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|