C13H17NO2 — CID 170857438
3-(5-methoxy-3-methyl-1H-indol-2-yl)propan-1-ol (PubChem CID 170857438) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 3-(5-methoxy-3-methyl-1H-indol-2-yl)propan-1-ol.
| Compound Name | 3-(5-methoxy-3-methyl-1H-indol-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 170857438 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 3-(5-methoxy-3-methyl-1H-indol-2-yl)propan-1-ol |
| SMILES | COc1ccc2[nH]c(CCCO)c(C)c2c1 |
| InChI | InChI=1S/C13H17NO2/c1-9-11-8-10(16-2)5-6-13(11)14-12(9)4-3-7-15/h5-6,8,14-15H,3-4,7H2,1-2H3 |
| InChIKey | RFMGGYCBZAJPIV-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 45.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|