C21H24N6O — CID 131930112
6-[4-[(5-methoxy-3-methyl-1H-indol-2-yl)methyl]piperazin-1-yl]imidazo[1,2-b]pyridazine (PubChem CID 131930112) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is 6-[4-[(5-methoxy-3-methyl-1H-indol-2-yl)methyl]piperazin-1-yl]imidazo[1,2-b]pyridazine.
| Compound Name | 6-[4-[(5-methoxy-3-methyl-1H-indol-2-yl)methyl]piperazin-1-yl]imidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 131930112 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 6-[4-[(5-methoxy-3-methyl-1H-indol-2-yl)methyl]piperazin-1-yl]imidazo[1,2-b]pyridazine |
| SMILES | COc1ccc2[nH]c(CN3CCN(c4ccc5nccn5n4)CC3)c(C)c2c1 |
| InChI | InChI=1S/C21H24N6O/c1-15-17-13-16(28-2)3-4-18(17)23-19(15)14-25-9-11-26(12-10-25)21-6-5-20-22-7-8-27(20)24-21/h3-8,13,23H,9-12,14H2,1-2H3 |
| InChIKey | VXOYGFQHYNMXSR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|